C14H22N2O2S — CID 107298582
4-(thiolan-3-ylmethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 107298582) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-(thiolan-3-ylmethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 4-(thiolan-3-ylmethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 107298582 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(thiolan-3-ylmethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CN(CC2CCSC2)C(=O)C2(CCCCC2)N1 |
| InChI | InChI=1S/C14H22N2O2S/c17-12-9-16(8-11-4-7-19-10-11)13(18)14(15-12)5-2-1-3-6-14/h11H,1-10H2,(H,15,17) |
| InChIKey | AYQPFTCXWXEFCJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |