C11H14N2O2 — CID 64963783
9-prop-2-ynyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64963783) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 9-prop-2-ynyl-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-prop-2-ynyl-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64963783 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 9-prop-2-ynyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | C#CCN1CC(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C11H14N2O2/c1-2-7-13-8-9(14)12-11(10(13)15)5-3-4-6-11/h1H,3-8H2,(H,12,14) |
| InChIKey | WUALXOIWPZFZMO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|