C13H22N2O3 — CID 64959195
9-(3-ethoxypropyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64959195) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 9-(3-ethoxypropyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-(3-ethoxypropyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64959195 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 9-(3-ethoxypropyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CCOCCCN1CC(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C13H22N2O3/c1-2-18-9-5-8-15-10-11(16)14-13(12(15)17)6-3-4-7-13/h2-10H2,1H3,(H,14,16) |
| InChIKey | DNUQNSPKGAAZJB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|