C14H22N2O3 — CID 106409784
9-(2-but-3-enoxyethyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 106409784) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 9-(2-but-3-enoxyethyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-(2-but-3-enoxyethyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 106409784 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 9-(2-but-3-enoxyethyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | C=CCCOCCN1CC(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C14H22N2O3/c1-2-3-9-19-10-8-16-11-12(17)15-14(13(16)18)6-4-5-7-14/h2H,1,3-11H2,(H,15,17) |
| InChIKey | HTUPDOJKIQEVHN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|