C14H24N2O4S — CID 106733699
4-(2-propylsulfonylethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 106733699) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(2-propylsulfonylethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 4-(2-propylsulfonylethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 106733699 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(2-propylsulfonylethyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCS(=O)(=O)CCN1CC(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C14H24N2O4S/c1-2-9-21(19,20)10-8-16-11-12(17)15-14(13(16)18)6-4-3-5-7-14/h2-11H2,1H3,(H,15,17) |
| InChIKey | IKRJWGSQFLHERA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |