C17H25ClN2O2 — CID 107299182
tert-butyl N-[(E)-4-[(4-chloro-2-methylphenyl)methylamino]but-2-enyl]carbamate (PubChem CID 107299182) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(4-chloro-2-methylphenyl)methylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(4-chloro-2-methylphenyl)methylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107299182 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | tert-butyl N-[(E)-4-[(4-chloro-2-methylphenyl)methylamino]but-2-enyl]carbamate |
| SMILES | Cc1cc(Cl)ccc1CNC/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25ClN2O2/c1-13-11-15(18)8-7-14(13)12-19-9-5-6-10-20-16(21)22-17(2,3)4/h5-8,11,19H,9-10,12H2,1-4H3,(H,20,21)/b6-5+ |
| InChIKey | MFAGRWRRBNUJHZ-AATRIKPKSA-N |
| XLogP | 3.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|