C14H20N4O2 — CID 107300375
N-(4-hydroxypentyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 107300375) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(4-hydroxypentyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 107300375 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(4-hydroxypentyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2ncc(C(=O)NCCCC(C)O)c2n1 |
| InChI | InChI=1S/C14H20N4O2/c1-9-7-10(2)18-13(17-9)12(8-16-18)14(20)15-6-4-5-11(3)19/h7-8,11,19H,4-6H2,1-3H3,(H,15,20) |
| InChIKey | XDUOHCKIWHHGSP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|