C15H16O4 — CID 10730038
4-methoxy-5-methyl-6-[(1E,3E,5E)-7-oxoocta-1,3,5-trienyl]pyran-2-one (PubChem CID 10730038) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-methoxy-5-methyl-6-[(1E,3E,5E)-7-oxoocta-1,3,5-trienyl]pyran-2-one.
| Compound Name | 4-methoxy-5-methyl-6-[(1E,3E,5E)-7-oxoocta-1,3,5-trienyl]pyran-2-one |
|---|---|
| PubChem CID | 10730038 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-methoxy-5-methyl-6-[(1E,3E,5E)-7-oxoocta-1,3,5-trienyl]pyran-2-one |
| SMILES | COc1cc(=O)oc(/C=C/C=C/C=C/C(C)=O)c1C |
| InChI | InChI=1S/C15H16O4/c1-11(16)8-6-4-5-7-9-13-12(2)14(18-3)10-15(17)19-13/h4-10H,1-3H3/b5-4+,8-6+,9-7+ |
| InChIKey | AEFRTTIJROBNDZ-WUJFNTSISA-N |
| XLogP | 2.67 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|