C15H27NO3 — CID 107301867
2-cycloheptyl-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide (PubChem CID 107301867) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-cycloheptyl-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide.
| Compound Name | 2-cycloheptyl-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 107301867 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2-cycloheptyl-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
| SMILES | CC1OCCC1(O)CNC(=O)CC1CCCCCC1 |
| InChI | InChI=1S/C15H27NO3/c1-12-15(18,8-9-19-12)11-16-14(17)10-13-6-4-2-3-5-7-13/h12-13,18H,2-11H2,1H3,(H,16,17) |
| InChIKey | ZRBCRXYUZQANML-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |