C12H23NO4 — CID 107302079
4-ethoxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]butanamide (PubChem CID 107302079) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-ethoxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]butanamide.
| Compound Name | 4-ethoxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 107302079 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-ethoxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]butanamide |
| SMILES | CCOCCCC(=O)NCC1(O)CCOC1C |
| InChI | InChI=1S/C12H23NO4/c1-3-16-7-4-5-11(14)13-9-12(15)6-8-17-10(12)2/h10,15H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | MWVLVHJBNLFMQX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|