C9H10F3N3OS — CID 107305985
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carbaldehyde (PubChem CID 107305985) has the molecular formula C9H10F3N3OS and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 107305985 |
| Molecular Formula | C9H10F3N3OS |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2nc(C(F)(F)F)ns2)CC1 |
| InChI | InChI=1S/C9H10F3N3OS/c10-9(11,12)7-13-8(17-14-7)15-3-1-6(5-16)2-4-15/h5-6H,1-4H2 |
| InChIKey | JSEKMPFDIZIACF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|