C6H3BrF3N3S — CID 107306026
3-bromo-2-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propanenitrile (PubChem CID 107306026) has the molecular formula C6H3BrF3N3S and a molecular weight of 286.08 g/mol. Its IUPAC name is 3-bromo-2-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propanenitrile.
| Compound Name | 3-bromo-2-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propanenitrile |
|---|---|
| PubChem CID | 107306026 |
| Molecular Formula | C6H3BrF3N3S |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.92 |
| IUPAC Name | 3-bromo-2-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propanenitrile |
| SMILES | N#CC(CBr)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C6H3BrF3N3S/c7-1-3(2-11)4-12-5(13-14-4)6(8,9)10/h3H,1H2 |
| InChIKey | PVEVPKGIXMOQKJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|