C15H12Cl2N2 — CID 107306399
4-[(2,3-dichlorophenyl)methyl-methylamino]benzonitrile (PubChem CID 107306399) has the molecular formula C15H12Cl2N2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 4-[(2,3-dichlorophenyl)methyl-methylamino]benzonitrile.
| Compound Name | 4-[(2,3-dichlorophenyl)methyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 107306399 |
| Molecular Formula | C15H12Cl2N2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-[(2,3-dichlorophenyl)methyl-methylamino]benzonitrile |
| SMILES | CN(Cc1cccc(Cl)c1Cl)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H12Cl2N2/c1-19(13-7-5-11(9-18)6-8-13)10-12-3-2-4-14(16)15(12)17/h2-8H,10H2,1H3 |
| InChIKey | UYUYSZPCOYFKCC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |