C12H10Cl2N2S — CID 107306654
4-[(2,3-dichlorophenyl)methylsulfanyl]pyridin-3-amine (PubChem CID 107306654) has the molecular formula C12H10Cl2N2S and a molecular weight of 285.20 g/mol. Its IUPAC name is 4-[(2,3-dichlorophenyl)methylsulfanyl]pyridin-3-amine.
| Compound Name | 4-[(2,3-dichlorophenyl)methylsulfanyl]pyridin-3-amine |
|---|---|
| PubChem CID | 107306654 |
| Molecular Formula | C12H10Cl2N2S |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 4-[(2,3-dichlorophenyl)methylsulfanyl]pyridin-3-amine |
| SMILES | Nc1cnccc1SCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl2N2S/c13-9-3-1-2-8(12(9)14)7-17-11-4-5-16-6-10(11)15/h1-6H,7,15H2 |
| InChIKey | RYJNFQJXGFKEOK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |