C12H9Cl2NS — CID 19590526
2-[(2,3-dichlorophenyl)methylsulfanyl]pyridine (PubChem CID 19590526) has the molecular formula C12H9Cl2NS and a molecular weight of 270.18 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylsulfanyl]pyridine.
| Compound Name | 2-[(2,3-dichlorophenyl)methylsulfanyl]pyridine |
|---|---|
| PubChem CID | 19590526 |
| Molecular Formula | C12H9Cl2NS |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylsulfanyl]pyridine |
| SMILES | Clc1cccc(CSc2ccccn2)c1Cl |
| InChI | InChI=1S/C12H9Cl2NS/c13-10-5-3-4-9(12(10)14)8-16-11-6-1-2-7-15-11/h1-7H,8H2 |
| InChIKey | ZGWHCSOLOQHGNP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |