C16H23Cl2NO2 — CID 107308193
1-(2,3-dichlorophenyl)-3-methyl-3-morpholin-4-ylpentan-2-ol (PubChem CID 107308193) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-methyl-3-morpholin-4-ylpentan-2-ol.
| Compound Name | 1-(2,3-dichlorophenyl)-3-methyl-3-morpholin-4-ylpentan-2-ol |
|---|---|
| PubChem CID | 107308193 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-methyl-3-morpholin-4-ylpentan-2-ol |
| SMILES | CCC(C)(C(O)Cc1cccc(Cl)c1Cl)N1CCOCC1 |
| InChI | InChI=1S/C16H23Cl2NO2/c1-3-16(2,19-7-9-21-10-8-19)14(20)11-12-5-4-6-13(17)15(12)18/h4-6,14,20H,3,7-11H2,1-2H3 |
| InChIKey | ANYOTXKNNYJVLP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |