C16H24ClNO3 — CID 79700570
1-(4-chloro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol (PubChem CID 79700570) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol |
|---|---|
| PubChem CID | 79700570 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol |
| SMILES | CCC(C)(C(O)c1ccc(Cl)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H24ClNO3/c1-4-16(2,18-7-9-21-10-8-18)15(19)12-5-6-13(17)14(11-12)20-3/h5-6,11,15,19H,4,7-10H2,1-3H3 |
| InChIKey | ISHYCSAQSIGEFW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |