C16H24FNO3 — CID 82791751
1-(2-fluoro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol (PubChem CID 82791751) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol |
|---|---|
| PubChem CID | 82791751 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)-2-methyl-2-morpholin-4-ylbutan-1-ol |
| SMILES | CCC(C)(C(O)c1cccc(OC)c1F)N1CCOCC1 |
| InChI | InChI=1S/C16H24FNO3/c1-4-16(2,18-8-10-21-11-9-18)15(19)12-6-5-7-13(20-3)14(12)17/h5-7,15,19H,4,8-11H2,1-3H3 |
| InChIKey | FPHMGCFIRSPQEB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |