C16H18Cl2N2 — CID 107308391
N-[2-(2,3-dichlorophenyl)-1-pyridin-2-ylethyl]propan-1-amine (PubChem CID 107308391) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)-1-pyridin-2-ylethyl]propan-1-amine.
| Compound Name | N-[2-(2,3-dichlorophenyl)-1-pyridin-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 107308391 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)-1-pyridin-2-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1Cl)c1ccccn1 |
| InChI | InChI=1S/C16H18Cl2N2/c1-2-9-19-15(14-8-3-4-10-20-14)11-12-6-5-7-13(17)16(12)18/h3-8,10,15,19H,2,9,11H2,1H3 |
| InChIKey | OYSYUCGDAXSAIW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |