C16H17Cl2NS — CID 107308753
1-(2,3-dichlorophenyl)-3-(4-methylphenyl)sulfanylpropan-2-amine (PubChem CID 107308753) has the molecular formula C16H17Cl2NS and a molecular weight of 326.29 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(4-methylphenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(4-methylphenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 107308753 |
| Molecular Formula | C16H17Cl2NS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(4-methylphenyl)sulfanylpropan-2-amine |
| SMILES | Cc1ccc(SCC(N)Cc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NS/c1-11-5-7-14(8-6-11)20-10-13(19)9-12-3-2-4-15(17)16(12)18/h2-8,13H,9-10,19H2,1H3 |
| InChIKey | HGRDMJJRGQBONS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |