C13H13Cl2NO — CID 107312036
2-(2,3-dichlorophenyl)-1-(5-methylfuran-3-yl)ethanamine (PubChem CID 107312036) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(5-methylfuran-3-yl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(5-methylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 107312036 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(5-methylfuran-3-yl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2cccc(Cl)c2Cl)co1 |
| InChI | InChI=1S/C13H13Cl2NO/c1-8-5-10(7-17-8)12(16)6-9-3-2-4-11(14)13(9)15/h2-5,7,12H,6,16H2,1H3 |
| InChIKey | YFESKXCWXOIQJI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |