C10H10Cl2N4 — CID 107308912
2-(2,3-dichlorophenyl)-1-(2H-triazol-4-yl)ethanamine (PubChem CID 107308912) has the molecular formula C10H10Cl2N4 and a molecular weight of 257.12 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(2H-triazol-4-yl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(2H-triazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107308912 |
| Molecular Formula | C10H10Cl2N4 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(2H-triazol-4-yl)ethanamine |
| SMILES | NC(Cc1cccc(Cl)c1Cl)c1cn[nH]n1 |
| InChI | InChI=1S/C10H10Cl2N4/c11-7-3-1-2-6(10(7)12)4-8(13)9-5-14-16-15-9/h1-3,5,8H,4,13H2,(H,14,15,16) |
| InChIKey | RMKIWEMXEORGOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |