C14H19Cl2F2NO — CID 107309180
1-(2,3-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine (PubChem CID 107309180) has the molecular formula C14H19Cl2F2NO and a molecular weight of 326.21 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine |
|---|---|
| PubChem CID | 107309180 |
| Molecular Formula | C14H19Cl2F2NO |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine |
| SMILES | CCNC(CCOCC(F)F)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2F2NO/c1-2-19-11(6-7-20-9-13(17)18)8-10-4-3-5-12(15)14(10)16/h3-5,11,13,19H,2,6-9H2,1H3 |
| InChIKey | TXRZJVFAEGTWHV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|