C16H17Cl2N — CID 107309611
2-benzyl-3-(2,3-dichlorophenyl)propan-1-amine (PubChem CID 107309611) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-benzyl-3-(2,3-dichlorophenyl)propan-1-amine.
| Compound Name | 2-benzyl-3-(2,3-dichlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 107309611 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-benzyl-3-(2,3-dichlorophenyl)propan-1-amine |
| SMILES | NCC(Cc1ccccc1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H17Cl2N/c17-15-8-4-7-14(16(15)18)10-13(11-19)9-12-5-2-1-3-6-12/h1-8,13H,9-11,19H2 |
| InChIKey | ZDRCTVSQFUIVFR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |