C10H13Cl2NO — CID 95001596
(2R)-2-(aminomethyl)-3-(2,3-dichlorophenyl)propan-1-ol (PubChem CID 95001596) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-3-(2,3-dichlorophenyl)propan-1-ol.
| Compound Name | (2R)-2-(aminomethyl)-3-(2,3-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 95001596 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (2R)-2-(aminomethyl)-3-(2,3-dichlorophenyl)propan-1-ol |
| SMILES | NC[C@H](CO)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO/c11-9-3-1-2-8(10(9)12)4-7(5-13)6-14/h1-3,7,14H,4-6,13H2/t7-/m1/s1 |
| InChIKey | RPCBQZHHUFVTPQ-SSDOTTSWSA-N |
| XLogP | 2.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |