C11H14BrCl2N — CID 107310059
1-bromo-N-[(2,3-dichlorophenyl)methyl]-N-methylpropan-2-amine (PubChem CID 107310059) has the molecular formula C11H14BrCl2N and a molecular weight of 311.05 g/mol. Its IUPAC name is 1-bromo-N-[(2,3-dichlorophenyl)methyl]-N-methylpropan-2-amine.
| Compound Name | 1-bromo-N-[(2,3-dichlorophenyl)methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 107310059 |
| Molecular Formula | C11H14BrCl2N |
| Molecular Weight | 311.05 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 1-bromo-N-[(2,3-dichlorophenyl)methyl]-N-methylpropan-2-amine |
| SMILES | CC(CBr)N(C)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14BrCl2N/c1-8(6-12)15(2)7-9-4-3-5-10(13)11(9)14/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | SOTLTWYGPMKRKE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.05 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|