C14H20Cl2N2 — CID 107310434
1-[(2,3-dichlorophenyl)methyl]-2-propylpiperazine (PubChem CID 107310434) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-2-propylpiperazine.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-2-propylpiperazine |
|---|---|
| PubChem CID | 107310434 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-2-propylpiperazine |
| SMILES | CCCC1CNCCN1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-4-12-9-17-7-8-18(12)10-11-5-3-6-13(15)14(11)16/h3,5-6,12,17H,2,4,7-10H2,1H3 |
| InChIKey | HPSXEPRBGPGDOX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |