C17H24O3 — CID 10731188
2-(2,2-dimethoxyethyl)-3-(4-methylphenyl)cyclohexan-1-one (PubChem CID 10731188) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-3-(4-methylphenyl)cyclohexan-1-one.
| Compound Name | 2-(2,2-dimethoxyethyl)-3-(4-methylphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 10731188 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-3-(4-methylphenyl)cyclohexan-1-one |
| SMILES | COC(CC1C(=O)CCCC1c1ccc(C)cc1)OC |
| InChI | InChI=1S/C17H24O3/c1-12-7-9-13(10-8-12)14-5-4-6-16(18)15(14)11-17(19-2)20-3/h7-10,14-15,17H,4-6,11H2,1-3H3 |
| InChIKey | BCVKECZWWRCHOD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|