C13H24O3 — CID 131845461
trans-(2R,3R)-3-tert-butyl-2-(2,2-dimethoxyethyl)cyclopentan-1-one (PubChem CID 131845461) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is trans-(2R,3R)-3-tert-butyl-2-(2,2-dimethoxyethyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-tert-butyl-2-(2,2-dimethoxyethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 131845461 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | trans-(2R,3R)-3-tert-butyl-2-(2,2-dimethoxyethyl)cyclopentan-1-one |
| SMILES | COC(C[C@H]1C(=O)CC[C@H]1C(C)(C)C)OC |
| InChI | InChI=1S/C13H24O3/c1-13(2,3)10-6-7-11(14)9(10)8-12(15-4)16-5/h9-10,12H,6-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | YZLGHIFKUMIQTM-NXEZZACHSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|