C12H24O5 — CID 155737505
2-(3,3-dimethoxypropyl)cyclobutan-1-one;propane-2,2-diol (PubChem CID 155737505) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)cyclobutan-1-one;propane-2,2-diol.
| Compound Name | 2-(3,3-dimethoxypropyl)cyclobutan-1-one;propane-2,2-diol |
|---|---|
| PubChem CID | 155737505 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)cyclobutan-1-one;propane-2,2-diol |
| SMILES | CC(C)(O)O.COC(CCC1CCC1=O)OC |
| InChI | InChI=1S/C9H16O3.C3H8O2/c1-11-9(12-2)6-4-7-3-5-8(7)10;1-3(2,4)5/h7,9H,3-6H2,1-2H3;4-5H,1-2H3 |
| InChIKey | GUZIVYMKEBJJQD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|