C14H18N2O4 — CID 10731281
(4R)-3-[(2R)-1-nitropentan-2-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10731281) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4R)-3-[(2R)-1-nitropentan-2-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R)-1-nitropentan-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10731281 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (4R)-3-[(2R)-1-nitropentan-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](C[N+](=O)[O-])N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-2-6-12(9-15(18)19)16-13(10-20-14(16)17)11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | VQJJOXRHTPPBDZ-OLZOCXBDSA-N |
| XLogP | 2.63 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|