C13H13NO2 — CID 10965904
(4R)-3-[(1Z)-buta-1,3-dienyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10965904) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4R)-3-[(1Z)-buta-1,3-dienyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1Z)-buta-1,3-dienyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10965904 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (4R)-3-[(1Z)-buta-1,3-dienyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C\N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H13NO2/c1-2-3-9-14-12(10-16-13(14)15)11-7-5-4-6-8-11/h2-9,12H,1,10H2/b9-3-/t12-/m0/s1 |
| InChIKey | FQAYNPFGYQICGC-PPFSTCQPSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|