C17H32OSi — CID 10731481
trimethyl-[2-[(2R,8S)-8-pentyloxocan-2-yl]ethynyl]silane (PubChem CID 10731481) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is trimethyl-[2-[(2R,8S)-8-pentyloxocan-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2R,8S)-8-pentyloxocan-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 10731481 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | trimethyl-[2-[(2R,8S)-8-pentyloxocan-2-yl]ethynyl]silane |
| SMILES | CCCCC[C@H]1CCCCC[C@H](C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H32OSi/c1-5-6-8-11-16-12-9-7-10-13-17(18-16)14-15-19(2,3)4/h16-17H,5-13H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | GJUGXAYCRSVVPV-DLBZAZTESA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|