C15H28OSi — CID 141368057
3-[(2S,3S)-3-heptyloxiran-2-yl]prop-1-ynyl-trimethylsilane (PubChem CID 141368057) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is 3-[(2S,3S)-3-heptyloxiran-2-yl]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[(2S,3S)-3-heptyloxiran-2-yl]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 141368057 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3-[(2S,3S)-3-heptyloxiran-2-yl]prop-1-ynyl-trimethylsilane |
| SMILES | CCCCCCC[C@@H]1O[C@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H28OSi/c1-5-6-7-8-9-11-14-15(16-14)12-10-13-17(2,3)4/h14-15H,5-9,11-12H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | NMCNKEXDYQRNOE-GJZGRUSLSA-N |
| XLogP | 4.39 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|