C13H17ClN2O3S — CID 107315305
(2R)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-(2-chlorophenyl)acetic acid (PubChem CID 107315305) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-(2-chlorophenyl)acetic acid.
| Compound Name | (2R)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-(2-chlorophenyl)acetic acid |
|---|---|
| PubChem CID | 107315305 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (2R)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-(2-chlorophenyl)acetic acid |
| SMILES | CSCC[C@@H](N)C(=O)N[C@@H](C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN2O3S/c1-20-7-6-10(15)12(17)16-11(13(18)19)8-4-2-3-5-9(8)14/h2-5,10-11H,6-7,15H2,1H3,(H,16,17)(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | CKQTVVJQOBBBQF-GHMZBOCLSA-N |
| XLogP | 1.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |