C14H20ClN3O3 — CID 107316066
(2R)-2-(2-chlorophenyl)-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]acetic acid (PubChem CID 107316066) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107316066 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]acetic acid |
| SMILES | CN(C)CCN(C)C(=O)N[C@@H](C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-17(2)8-9-18(3)14(21)16-12(13(19)20)10-6-4-5-7-11(10)15/h4-7,12H,8-9H2,1-3H3,(H,16,21)(H,19,20)/t12-/m1/s1 |
| InChIKey | MMOYVRXWVVIWLP-GFCCVEGCSA-N |
| XLogP | 1.67 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |