C14H19ClN2O4 — CID 107316130
(2R)-2-(2-chlorophenyl)-2-[[ethyl(3-hydroxypropyl)carbamoyl]amino]acetic acid (PubChem CID 107316130) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-[[ethyl(3-hydroxypropyl)carbamoyl]amino]acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-[[ethyl(3-hydroxypropyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107316130 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-[[ethyl(3-hydroxypropyl)carbamoyl]amino]acetic acid |
| SMILES | CCN(CCCO)C(=O)N[C@@H](C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C14H19ClN2O4/c1-2-17(8-5-9-18)14(21)16-12(13(19)20)10-6-3-4-7-11(10)15/h3-4,6-7,12,18H,2,5,8-9H2,1H3,(H,16,21)(H,19,20)/t12-/m1/s1 |
| InChIKey | VNMMRFNWWYLKLI-GFCCVEGCSA-N |
| XLogP | 1.88 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |