C14H15ClN2O3 — CID 107316075
(2R)-2-(2-chlorophenyl)-2-(2-methylbut-3-yn-2-ylcarbamoylamino)acetic acid (PubChem CID 107316075) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-(2-methylbut-3-yn-2-ylcarbamoylamino)acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-(2-methylbut-3-yn-2-ylcarbamoylamino)acetic acid |
|---|---|
| PubChem CID | 107316075 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-(2-methylbut-3-yn-2-ylcarbamoylamino)acetic acid |
| SMILES | C#CC(C)(C)NC(=O)N[C@@H](C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN2O3/c1-4-14(2,3)17-13(20)16-11(12(18)19)9-7-5-6-8-10(9)15/h1,5-8,11H,2-3H3,(H,18,19)(H2,16,17,20)/t11-/m1/s1 |
| InChIKey | PEZKOAOZIUOYPC-LLVKDONJSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|