C14H17ClN2O3 — CID 107315338
(2R)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-2-(2-chlorophenyl)acetic acid (PubChem CID 107315338) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is (2R)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-2-(2-chlorophenyl)acetic acid.
| Compound Name | (2R)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-2-(2-chlorophenyl)acetic acid |
|---|---|
| PubChem CID | 107315338 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (2R)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-2-(2-chlorophenyl)acetic acid |
| SMILES | CC(N)(C(=O)N[C@@H](C(=O)O)c1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-14(16,8-6-7-8)13(20)17-11(12(18)19)9-4-2-3-5-10(9)15/h2-5,8,11H,6-7,16H2,1H3,(H,17,20)(H,18,19)/t11-,14?/m1/s1 |
| InChIKey | SCKRRQZSNIACHW-YNODCEANSA-N |
| XLogP | 1.71 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |