C16H28O4 — CID 10731795
methyl (Z,8R)-8-methyl-9-(oxan-2-yloxy)non-2-enoate (PubChem CID 10731795) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl (Z,8R)-8-methyl-9-(oxan-2-yloxy)non-2-enoate.
| Compound Name | methyl (Z,8R)-8-methyl-9-(oxan-2-yloxy)non-2-enoate |
|---|---|
| PubChem CID | 10731795 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | methyl (Z,8R)-8-methyl-9-(oxan-2-yloxy)non-2-enoate |
| SMILES | COC(=O)/C=C\CCCC[C@@H](C)COC1CCCCO1 |
| InChI | InChI=1S/C16H28O4/c1-14(13-20-16-11-7-8-12-19-16)9-5-3-4-6-10-15(17)18-2/h6,10,14,16H,3-5,7-9,11-13H2,1-2H3/b10-6-/t14-,16?/m1/s1 |
| InChIKey | XFGRJDYYBKSWMG-LPBZSEGESA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|