C12H15FN2O4 — CID 107318410
2-fluoro-N-(5-hydroxypentyl)-4-nitrobenzamide (PubChem CID 107318410) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-fluoro-N-(5-hydroxypentyl)-4-nitrobenzamide.
| Compound Name | 2-fluoro-N-(5-hydroxypentyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 107318410 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-fluoro-N-(5-hydroxypentyl)-4-nitrobenzamide |
| SMILES | O=C(NCCCCCO)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H15FN2O4/c13-11-8-9(15(18)19)4-5-10(11)12(17)14-6-2-1-3-7-16/h4-5,8,16H,1-3,6-7H2,(H,14,17) |
| InChIKey | QDXHHNFWWRGPKM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|