C16H15FN2O4 — CID 111472014
2-fluoro-N-(3-hydroxy-3-phenylpropyl)-4-nitrobenzamide (PubChem CID 111472014) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-fluoro-N-(3-hydroxy-3-phenylpropyl)-4-nitrobenzamide.
| Compound Name | 2-fluoro-N-(3-hydroxy-3-phenylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 111472014 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-fluoro-N-(3-hydroxy-3-phenylpropyl)-4-nitrobenzamide |
| SMILES | O=C(NCCC(O)c1ccccc1)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C16H15FN2O4/c17-14-10-12(19(22)23)6-7-13(14)16(21)18-9-8-15(20)11-4-2-1-3-5-11/h1-7,10,15,20H,8-9H2,(H,18,21) |
| InChIKey | WWAZUJSXCLTKMI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|