C11H18N2O3 — CID 107318424
N-(5-hydroxypentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 107318424) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 107318424 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-(5-hydroxypentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCCCCCO)o1 |
| InChI | InChI=1S/C11H18N2O3/c1-8-10(16-9(2)13-8)11(15)12-6-4-3-5-7-14/h14H,3-7H2,1-2H3,(H,12,15) |
| InChIKey | YSCHHHHHAUWNMU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|