C9H14N2O3 — CID 110684796
N-(2-methoxyethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 110684796) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110684796 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(2-methoxyethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)c1oc(C)nc1C |
| InChI | InChI=1S/C9H14N2O3/c1-6-8(14-7(2)11-6)9(12)10-4-5-13-3/h4-5H2,1-3H3,(H,10,12) |
| InChIKey | BUKZXVWSIJVGRH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|