C14H20BrN3 — CID 107320459
5-bromo-N-[(1-methylindazol-3-yl)methyl]pentan-1-amine (PubChem CID 107320459) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-bromo-N-[(1-methylindazol-3-yl)methyl]pentan-1-amine.
| Compound Name | 5-bromo-N-[(1-methylindazol-3-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 107320459 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-bromo-N-[(1-methylindazol-3-yl)methyl]pentan-1-amine |
| SMILES | Cn1nc(CNCCCCCBr)c2ccccc21 |
| InChI | InChI=1S/C14H20BrN3/c1-18-14-8-4-3-7-12(14)13(17-18)11-16-10-6-2-5-9-15/h3-4,7-8,16H,2,5-6,9-11H2,1H3 |
| InChIKey | FIGLUBOZKHQUPB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|