C13H16F2N2O2 — CID 107321157
3-amino-1-[[3-(difluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 107321157) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3-amino-1-[[3-(difluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[[3-(difluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107321157 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-amino-1-[[3-(difluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(Cc2cccc(C(F)F)c2)C1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-11(15)10-3-1-2-9(6-10)7-17-5-4-13(16,8-17)12(18)19/h1-3,6,11H,4-5,7-8,16H2,(H,18,19) |
| InChIKey | RDGMAYOMDTVUSH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |