C12H15ClN2O3 — CID 107321493
3-amino-1-[(2-chloro-6-hydroxyphenyl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 107321493) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-amino-1-[(2-chloro-6-hydroxyphenyl)methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[(2-chloro-6-hydroxyphenyl)methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107321493 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-amino-1-[(2-chloro-6-hydroxyphenyl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(Cc2c(O)cccc2Cl)C1 |
| InChI | InChI=1S/C12H15ClN2O3/c13-9-2-1-3-10(16)8(9)6-15-5-4-12(14,7-15)11(17)18/h1-3,16H,4-7,14H2,(H,17,18) |
| InChIKey | DAISGQVZIPJCPA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|