C11H13Cl2N3O2 — CID 107324529
3-amino-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 107324529) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-amino-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107324529 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 3-amino-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(Cc2nc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C11H13Cl2N3O2/c12-7-1-2-9(13)15-8(7)5-16-4-3-11(14,6-16)10(17)18/h1-2H,3-6,14H2,(H,17,18) |
| InChIKey | VISVKSXAUPZCJH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|