About 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid
3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid (PubChem CID 107321483) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 107321483 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC1CC(C)(C)CCC1N1CCC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H26N2O2/c1-10-8-13(2,3)5-4-11(10)16-7-6-14(15,9-16)12(17)18/h10-11H,4-9,15H2,1-3H3,(H,17,18) |
| InChIKey | LKSPTHVABXCBHA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid (CID 107321483) is 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid is CC1CC(C)(C)CCC1N1CCC(N)(C(=O)O)C1.
What is the InChIKey of 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The InChIKey is LKSPTHVABXCBHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-10-8-13(2,3)5-4-11(10)16-7-6-14(15,9-16)12(17)18/h10-11H,4-9,15H2,1-3H3,(H,17,18).
What are the key properties of 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid has a molecular weight of 254.37 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,4,4-trimethylcyclohexyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 107321483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).