C12H22N2O3 — CID 107321554
3-amino-1-(3-methoxycyclohexyl)pyrrolidine-3-carboxylic acid (PubChem CID 107321554) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-amino-1-(3-methoxycyclohexyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(3-methoxycyclohexyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107321554 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-amino-1-(3-methoxycyclohexyl)pyrrolidine-3-carboxylic acid |
| SMILES | COC1CCCC(N2CCC(N)(C(=O)O)C2)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-17-10-4-2-3-9(7-10)14-6-5-12(13,8-14)11(15)16/h9-10H,2-8,13H2,1H3,(H,15,16) |
| InChIKey | RXBSNLSKWOQKCU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |